C7H8F3N2NaO5S — CID 165149743
sodium [7-oxo-2-(trifluoromethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 165149743) has the molecular formula C7H8F3N2NaO5S and a molecular weight of 312.20 g/mol. Its IUPAC name is sodium [7-oxo-2-(trifluoromethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [7-oxo-2-(trifluoromethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 165149743 |
| Molecular Formula | C7H8F3N2NaO5S |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | sodium [7-oxo-2-(trifluoromethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | O=C1N2CC(CCC2C(F)(F)F)N1OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H9F3N2O5S.Na/c8-7(9,10)5-2-1-4-3-11(5)6(13)12(4)17-18(14,15)16;/h4-5H,1-3H2,(H,14,15,16);/q;+1/p-1 |
| InChIKey | PGUPHMCIWOLKMG-UHFFFAOYSA-M |
| XLogP | -2.79 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|