C23H25ClN6O3S — CID 16515351
2-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-nitrophenyl)acetamide (PubChem CID 16515351) has the molecular formula C23H25ClN6O3S and a molecular weight of 501.01 g/mol. Its IUPAC name is 2-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-nitrophenyl)acetamide.
| Compound Name | 2-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16515351 |
| Molecular Formula | C23H25ClN6O3S |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 2-[[4-benzyl-5-(piperidin-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nnc(CN2CCCCC2)n1Cc1ccccc1)Nc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H25ClN6O3S/c24-18-9-10-20(30(32)33)19(13-18)25-22(31)16-34-23-27-26-21(15-28-11-5-2-6-12-28)29(23)14-17-7-3-1-4-8-17/h1,3-4,7-10,13H,2,5-6,11-12,14-16H2,(H,25,31) |
| InChIKey | CMBQTALOHJIWFP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|