C19H23ClN6O3S — CID 16961462
N-(5-chloro-2-nitrophenyl)-2-[[4-cyclopropyl-5-(4-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 16961462) has the molecular formula C19H23ClN6O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is N-(5-chloro-2-nitrophenyl)-2-[[4-cyclopropyl-5-(4-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(5-chloro-2-nitrophenyl)-2-[[4-cyclopropyl-5-(4-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 16961462 |
| Molecular Formula | C19H23ClN6O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-(5-chloro-2-nitrophenyl)-2-[[4-cyclopropyl-5-(4-methylpiperidin-1-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC1CCN(c2nnc(SCC(=O)Nc3cc(Cl)ccc3[N+](=O)[O-])n2C2CC2)CC1 |
| InChI | InChI=1S/C19H23ClN6O3S/c1-12-6-8-24(9-7-12)18-22-23-19(25(18)14-3-4-14)30-11-17(27)21-15-10-13(20)2-5-16(15)26(28)29/h2,5,10,12,14H,3-4,6-9,11H2,1H3,(H,21,27) |
| InChIKey | ICMXYXQCRUEWBP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|