C17H19FN6O4S — CID 16585748
2-[(4-cyclopropyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-fluoro-3-nitrophenyl)acetamide (PubChem CID 16585748) has the molecular formula C17H19FN6O4S and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-fluoro-3-nitrophenyl)acetamide.
| Compound Name | 2-[(4-cyclopropyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-fluoro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16585748 |
| Molecular Formula | C17H19FN6O4S |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[(4-cyclopropyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-fluoro-3-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nnc(N2CCOCC2)n1C1CC1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19FN6O4S/c18-13-4-1-11(9-14(13)24(26)27)19-15(25)10-29-17-21-20-16(23(17)12-2-3-12)22-5-7-28-8-6-22/h1,4,9,12H,2-3,5-8,10H2,(H,19,25) |
| InChIKey | UUSJBHGHFCJDAN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|