C42H26O — CID 165153908
12-[2,6-dideuterio-10-(4-phenylphenyl)anthracen-9-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene (PubChem CID 165153908) has the molecular formula C42H26O and a molecular weight of 548.68 g/mol. Its IUPAC name is 12-[2,6-dideuterio-10-(4-phenylphenyl)anthracen-9-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene.
| Compound Name | 12-[2,6-dideuterio-10-(4-phenylphenyl)anthracen-9-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
|---|---|
| PubChem CID | 165153908 |
| Molecular Formula | C42H26O |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 12-[2,6-dideuterio-10-(4-phenylphenyl)anthracen-9-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
| SMILES | [2H]c1ccc2c(-c3ccc4c5c(cccc35)-c3ccccc3O4)c3cc([2H])ccc3c(-c3ccc(-c4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C42H26O/c1-2-11-27(12-3-1)28-21-23-29(24-22-28)40-32-14-4-6-16-34(32)41(35-17-7-5-15-33(35)40)37-25-26-39-42-31(18-10-19-36(37)42)30-13-8-9-20-38(30)43-39/h1-26H/i4D,7D |
| InChIKey | VTAXDMNBUYYGGW-LZWIMIHNSA-N |
| XLogP | 11.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|