C42H26O — CID 165153969
4-[2,3,6,7-tetradeuterio-10-(2-phenylphenyl)anthracen-9-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene (PubChem CID 165153969) has the molecular formula C42H26O and a molecular weight of 550.69 g/mol. Its IUPAC name is 4-[2,3,6,7-tetradeuterio-10-(2-phenylphenyl)anthracen-9-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene.
| Compound Name | 4-[2,3,6,7-tetradeuterio-10-(2-phenylphenyl)anthracen-9-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 165153969 |
| Molecular Formula | C42H26O |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 4-[2,3,6,7-tetradeuterio-10-(2-phenylphenyl)anthracen-9-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
| SMILES | [2H]c1cc2c(-c3ccc4c(c3)-c3cccc5cccc(c35)O4)c3cc([2H])c([2H])cc3c(-c3ccccc3-c3ccccc3)c2cc1[2H] |
| InChI | InChI=1S/C42H26O/c1-2-12-27(13-3-1)30-16-4-5-17-31(30)42-34-20-8-6-18-32(34)40(33-19-7-9-21-35(33)42)29-24-25-38-37(26-29)36-22-10-14-28-15-11-23-39(43-38)41(28)36/h1-26H/i6D,7D,8D,9D |
| InChIKey | PQWQMMYCIBAQEW-YKVCKAMESA-N |
| XLogP | 11.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|