C32H20OS — CID 177298217
4-[5-(4-phenylphenyl)thiophen-2-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene (PubChem CID 177298217) has the molecular formula C32H20OS and a molecular weight of 452.58 g/mol. Its IUPAC name is 4-[5-(4-phenylphenyl)thiophen-2-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene.
| Compound Name | 4-[5-(4-phenylphenyl)thiophen-2-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 177298217 |
| Molecular Formula | C32H20OS |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 4-[5-(4-phenylphenyl)thiophen-2-yl]-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
| SMILES | c1ccc(-c2ccc(-c3ccc(-c4ccc5c(c4)-c4cccc6cccc(c46)O5)s3)cc2)cc1 |
| InChI | InChI=1S/C32H20OS/c1-2-6-21(7-3-1)22-12-14-23(15-13-22)30-18-19-31(34-30)25-16-17-28-27(20-25)26-10-4-8-24-9-5-11-29(33-28)32(24)26/h1-20H |
| InChIKey | GUWJNQCGGKPZMK-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |