C24H23ClN4O2S — CID 165154183
N-[(1-aminoisoquinolin-6-yl)methyl]-4-chloro-5-(3-pyridin-2-ylpropoxymethyl)thiophene-2-carboxamide (PubChem CID 165154183) has the molecular formula C24H23ClN4O2S and a molecular weight of 466.99 g/mol. Its IUPAC name is N-[(1-aminoisoquinolin-6-yl)methyl]-4-chloro-5-(3-pyridin-2-ylpropoxymethyl)thiophene-2-carboxamide.
| Compound Name | N-[(1-aminoisoquinolin-6-yl)methyl]-4-chloro-5-(3-pyridin-2-ylpropoxymethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 165154183 |
| Molecular Formula | C24H23ClN4O2S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-[(1-aminoisoquinolin-6-yl)methyl]-4-chloro-5-(3-pyridin-2-ylpropoxymethyl)thiophene-2-carboxamide |
| SMILES | Nc1nccc2cc(CNC(=O)c3cc(Cl)c(COCCCc4ccccn4)s3)ccc12 |
| InChI | InChI=1S/C24H23ClN4O2S/c25-20-13-21(32-22(20)15-31-11-3-5-18-4-1-2-9-27-18)24(30)29-14-16-6-7-19-17(12-16)8-10-28-23(19)26/h1-2,4,6-10,12-13H,3,5,11,14-15H2,(H2,26,28)(H,29,30) |
| InChIKey | NKMTVRPKYPHSNZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|