C22H27ClN4O2S — CID 167553538
N-[(1-aminoisoquinolin-6-yl)methyl]-4-chloro-5-[(4-oxopentylamino)methyl]thiophene-2-carboxamide;methane (PubChem CID 167553538) has the molecular formula C22H27ClN4O2S and a molecular weight of 447.00 g/mol. Its IUPAC name is N-[(1-aminoisoquinolin-6-yl)methyl]-4-chloro-5-[(4-oxopentylamino)methyl]thiophene-2-carboxamide;methane.
| Compound Name | N-[(1-aminoisoquinolin-6-yl)methyl]-4-chloro-5-[(4-oxopentylamino)methyl]thiophene-2-carboxamide;methane |
|---|---|
| PubChem CID | 167553538 |
| Molecular Formula | C22H27ClN4O2S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-[(1-aminoisoquinolin-6-yl)methyl]-4-chloro-5-[(4-oxopentylamino)methyl]thiophene-2-carboxamide;methane |
| SMILES | C.CC(=O)CCCNCc1sc(C(=O)NCc2ccc3c(N)nccc3c2)cc1Cl |
| InChI | InChI=1S/C21H23ClN4O2S.CH4/c1-13(27)3-2-7-24-12-19-17(22)10-18(29-19)21(28)26-11-14-4-5-16-15(9-14)6-8-25-20(16)23;/h4-6,8-10,24H,2-3,7,11-12H2,1H3,(H2,23,25)(H,26,28);1H4 |
| InChIKey | CSFUEBSBMRPCSO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|