C28H32N6O2 — CID 165155947
1-[2-(4-methylpiperazin-1-yl)-5-[[6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one (PubChem CID 165155947) has the molecular formula C28H32N6O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 1-[2-(4-methylpiperazin-1-yl)-5-[[6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one.
| Compound Name | 1-[2-(4-methylpiperazin-1-yl)-5-[[6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 165155947 |
| Molecular Formula | C28H32N6O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 1-[2-(4-methylpiperazin-1-yl)-5-[[6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(Nc2cc(N3OCC[C@@H]3c3ccccc3)ncn2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C28H32N6O2/c1-3-24(35)18-22-17-23(9-10-25(22)33-14-12-32(2)13-15-33)31-27-19-28(30-20-29-27)34-26(11-16-36-34)21-7-5-4-6-8-21/h3-10,17,19-20,26H,1,11-16,18H2,2H3,(H,29,30,31)/t26-/m1/s1 |
| InChIKey | LMXCBTZZERAUIS-AREMUKBSSA-N |
| XLogP | 4.15 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|