C26H29F3N6O2 — CID 166135340
N-[4-(4-methylpiperazin-1-yl)-3-(2,2,2-trifluoroethoxy)phenyl]-6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-amine (PubChem CID 166135340) has the molecular formula C26H29F3N6O2 and a molecular weight of 514.55 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)-3-(2,2,2-trifluoroethoxy)phenyl]-6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)-3-(2,2,2-trifluoroethoxy)phenyl]-6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166135340 |
| Molecular Formula | C26H29F3N6O2 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)-3-(2,2,2-trifluoroethoxy)phenyl]-6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-amine |
| SMILES | CN1CCN(c2ccc(Nc3cc(N4OCC[C@@H]4c4ccccc4)ncn3)cc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C26H29F3N6O2/c1-33-10-12-34(13-11-33)22-8-7-20(15-23(22)36-17-26(27,28)29)32-24-16-25(31-18-30-24)35-21(9-14-37-35)19-5-3-2-4-6-19/h2-8,15-16,18,21H,9-14,17H2,1H3,(H,30,31,32)/t21-/m1/s1 |
| InChIKey | HHKMELPIFCDRIT-OAQYLSRUSA-N |
| XLogP | 4.80 |
| TPSA | 65.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|