C24H27N5O2 — CID 166135255
N-(2-methyl-4-morpholin-4-ylphenyl)-6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-amine (PubChem CID 166135255) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-(2-methyl-4-morpholin-4-ylphenyl)-6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-amine.
| Compound Name | N-(2-methyl-4-morpholin-4-ylphenyl)-6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166135255 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-(2-methyl-4-morpholin-4-ylphenyl)-6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-amine |
| SMILES | Cc1cc(N2CCOCC2)ccc1Nc1cc(N2OCC[C@@H]2c2ccccc2)ncn1 |
| InChI | InChI=1S/C24H27N5O2/c1-18-15-20(28-10-13-30-14-11-28)7-8-21(18)27-23-16-24(26-17-25-23)29-22(9-12-31-29)19-5-3-2-4-6-19/h2-8,15-17,22H,9-14H2,1H3,(H,25,26,27)/t22-/m1/s1 |
| InChIKey | KELUXKJOKUKGSY-JOCHJYFZSA-N |
| XLogP | 4.25 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|