C20H18FN5O4 — CID 155128277
N-(4-fluoro-2-methoxy-5-nitrophenyl)-6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-amine (PubChem CID 155128277) has the molecular formula C20H18FN5O4 and a molecular weight of 411.39 g/mol. Its IUPAC name is N-(4-fluoro-2-methoxy-5-nitrophenyl)-6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-amine.
| Compound Name | N-(4-fluoro-2-methoxy-5-nitrophenyl)-6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155128277 |
| Molecular Formula | C20H18FN5O4 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-(4-fluoro-2-methoxy-5-nitrophenyl)-6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-amine |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1cc(N2OCC[C@@H]2c2ccccc2)ncn1 |
| InChI | InChI=1S/C20H18FN5O4/c1-29-18-9-14(21)17(26(27)28)10-15(18)24-19-11-20(23-12-22-19)25-16(7-8-30-25)13-5-3-2-4-6-13/h2-6,9-12,16H,7-8H2,1H3,(H,22,23,24)/t16-/m1/s1 |
| InChIKey | YMCSJIRKOOYJEY-MRXNPFEDSA-N |
| XLogP | 4.16 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|