C25H31N7O4 — CID 155695758
4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitro-1-N-[6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-yl]benzene-1,4-diamine (PubChem CID 155695758) has the molecular formula C25H31N7O4 and a molecular weight of 493.57 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitro-1-N-[6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitro-1-N-[6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 155695758 |
| Molecular Formula | C25H31N7O4 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitro-1-N-[6-[(3R)-3-phenyl-1,2-oxazolidin-2-yl]pyrimidin-4-yl]benzene-1,4-diamine |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1cc(N2OCC[C@@H]2c2ccccc2)ncn1 |
| InChI | InChI=1S/C25H31N7O4/c1-29(2)11-12-30(3)21-15-23(35-4)19(14-22(21)32(33)34)28-24-16-25(27-17-26-24)31-20(10-13-36-31)18-8-6-5-7-9-18/h5-9,14-17,20H,10-13H2,1-4H3,(H,26,27,28)/t20-/m1/s1 |
| InChIKey | ITWGNYYBQGMREK-HXUWFJFHSA-N |
| XLogP | 4.02 |
| TPSA | 109.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|