C26H32N6O4 — CID 155631253
[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-pyridinyl]-[4-(dimethylamino)phenyl]methanone (PubChem CID 155631253) has the molecular formula C26H32N6O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is [2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-pyridinyl]-[4-(dimethylamino)phenyl]methanone.
| Compound Name | [2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-pyridinyl]-[4-(dimethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 155631253 |
| Molecular Formula | C26H32N6O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | [2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-pyridinyl]-[4-(dimethylamino)phenyl]methanone |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1cc(C(=O)c2ccc(N(C)C)cc2)ccn1 |
| InChI | InChI=1S/C26H32N6O4/c1-29(2)13-14-31(5)22-17-24(36-6)21(16-23(22)32(34)35)28-25-15-19(11-12-27-25)26(33)18-7-9-20(10-8-18)30(3)4/h7-12,15-17H,13-14H2,1-6H3,(H,27,28) |
| InChIKey | ZOXJWXWTACNECS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|