C14H24N6O3 — CID 145449390
1-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitrophenyl]-2-methylguanidine (PubChem CID 145449390) has the molecular formula C14H24N6O3 and a molecular weight of 324.39 g/mol. Its IUPAC name is 1-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitrophenyl]-2-methylguanidine.
| Compound Name | 1-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitrophenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 145449390 |
| Molecular Formula | C14H24N6O3 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 1-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitrophenyl]-2-methylguanidine |
| SMILES | C/N=C(\N)Nc1cc([N+](=O)[O-])c(N(C)CCN(C)C)cc1OC |
| InChI | InChI=1S/C14H24N6O3/c1-16-14(15)17-10-8-12(20(21)22)11(9-13(10)23-5)19(4)7-6-18(2)3/h8-9H,6-7H2,1-5H3,(H3,15,16,17) |
| InChIKey | RIOHUYRTZPOQPP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|