C15H24N4O3 — CID 146561159
4-cyclopropyloxy-2-N-[2-(dimethylamino)ethyl]-1-N,2-N-dimethyl-5-nitrobenzene-1,2-diamine (PubChem CID 146561159) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-cyclopropyloxy-2-N-[2-(dimethylamino)ethyl]-1-N,2-N-dimethyl-5-nitrobenzene-1,2-diamine.
| Compound Name | 4-cyclopropyloxy-2-N-[2-(dimethylamino)ethyl]-1-N,2-N-dimethyl-5-nitrobenzene-1,2-diamine |
|---|---|
| PubChem CID | 146561159 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 4-cyclopropyloxy-2-N-[2-(dimethylamino)ethyl]-1-N,2-N-dimethyl-5-nitrobenzene-1,2-diamine |
| SMILES | CNc1cc([N+](=O)[O-])c(OC2CC2)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C15H24N4O3/c1-16-12-9-14(19(20)21)15(22-11-5-6-11)10-13(12)18(4)8-7-17(2)3/h9-11,16H,5-8H2,1-4H3 |
| InChIKey | LYCXYWPOPLOPLA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|