C18H28N6O3 — CID 144945496
(1Z)-1-but-3-en-2-ylidene-3-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitrophenyl]-2-methylguanidine (PubChem CID 144945496) has the molecular formula C18H28N6O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (1Z)-1-but-3-en-2-ylidene-3-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitrophenyl]-2-methylguanidine.
| Compound Name | (1Z)-1-but-3-en-2-ylidene-3-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitrophenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 144945496 |
| Molecular Formula | C18H28N6O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (1Z)-1-but-3-en-2-ylidene-3-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitrophenyl]-2-methylguanidine |
| SMILES | C=C/C(C)=N\C(=N/C)Nc1cc([N+](=O)[O-])c(N(C)CCN(C)C)cc1OC |
| InChI | InChI=1S/C18H28N6O3/c1-8-13(2)20-18(19-3)21-14-11-16(24(25)26)15(12-17(14)27-7)23(6)10-9-22(4)5/h8,11-12H,1,9-10H2,2-7H3,(H,19,21)/b20-13- |
| InChIKey | XGRBPANVQIOABO-MOSHPQCFSA-N |
| XLogP | 2.65 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|