C28H35N7O3 — CID 144961341
(1E)-1-[1-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-methylprop-2-enylidene]-3-[4-[2-(dimethylamino)ethylamino]-2-methoxy-5-nitrophenyl]-2-methylguanidine (PubChem CID 144961341) has the molecular formula C28H35N7O3 and a molecular weight of 517.63 g/mol. Its IUPAC name is (1E)-1-[1-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-methylprop-2-enylidene]-3-[4-[2-(dimethylamino)ethylamino]-2-methoxy-5-nitrophenyl]-2-methylguanidine.
| Compound Name | (1E)-1-[1-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-methylprop-2-enylidene]-3-[4-[2-(dimethylamino)ethylamino]-2-methoxy-5-nitrophenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 144961341 |
| Molecular Formula | C28H35N7O3 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | (1E)-1-[1-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-methylprop-2-enylidene]-3-[4-[2-(dimethylamino)ethylamino]-2-methoxy-5-nitrophenyl]-2-methylguanidine |
| SMILES | C=C(C)/C(=N\C(=N\C)Nc1cc([N+](=O)[O-])c(NCCN(C)C)cc1OC)c1cn2c3c(cccc13)CCC2 |
| InChI | InChI=1S/C28H35N7O3/c1-18(2)26(21-17-34-13-8-10-19-9-7-11-20(21)27(19)34)32-28(29-3)31-23-15-24(35(36)37)22(16-25(23)38-6)30-12-14-33(4)5/h7,9,11,15-17,30H,1,8,10,12-14H2,2-6H3,(H,29,31)/b32-26+ |
| InChIKey | AEGSRKZBFUIDCD-HMZBKAONSA-N |
| XLogP | 4.94 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|