C34H46N6O — CID 123277506
N-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyphenyl]-N'-[1-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-ethenylbuta-1,3-dienyl]-2-methylbutanimidamide (PubChem CID 123277506) has the molecular formula C34H46N6O and a molecular weight of 554.78 g/mol. Its IUPAC name is N-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyphenyl]-N'-[1-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-ethenylbuta-1,3-dienyl]-2-methylbutanimidamide.
| Compound Name | N-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyphenyl]-N'-[1-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-ethenylbuta-1,3-dienyl]-2-methylbutanimidamide |
|---|---|
| PubChem CID | 123277506 |
| Molecular Formula | C34H46N6O |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.37 |
| IUPAC Name | N-[5-amino-4-[2-(dimethylamino)ethyl-methylamino]-2-methoxyphenyl]-N'-[1-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2-ethenylbuta-1,3-dienyl]-2-methylbutanimidamide |
| SMILES | C=CC(C=C)=C(/N=C(\Nc1cc(N)c(N(C)CCN(C)C)cc1OC)C(C)CC)c1cn2c3c(cccc13)CCC2 |
| InChI | InChI=1S/C34H46N6O/c1-9-23(4)34(36-29-20-28(35)30(21-31(29)41-8)39(7)19-18-38(5)6)37-32(24(10-2)11-3)27-22-40-17-13-15-25-14-12-16-26(27)33(25)40/h10-12,14,16,20-23H,2-3,9,13,15,17-19,35H2,1,4-8H3,(H,36,37) |
| InChIKey | JTHUVLSOYKPPIS-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|