C19H18N4 — CID 165156524
4-(3-phenylpiperidin-1-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile (PubChem CID 165156524) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-(3-phenylpiperidin-1-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile.
| Compound Name | 4-(3-phenylpiperidin-1-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 165156524 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-(3-phenylpiperidin-1-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile |
| SMILES | N#Cc1c[nH]c2nccc(N3CCCC(c4ccccc4)C3)c12 |
| InChI | InChI=1S/C19H18N4/c20-11-16-12-22-19-18(16)17(8-9-21-19)23-10-4-7-15(13-23)14-5-2-1-3-6-14/h1-3,5-6,8-9,12,15H,4,7,10,13H2,(H,21,22) |
| InChIKey | MCFSCRWDEDSWMA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |