C31H31Cl2N7O3 — CID 165158619
12-chloro-13-(2-chloro-6-hydroxyphenyl)-16-(4-methyl-2-propan-2-yl-3-pyridinyl)-5-prop-2-enoyl-2,5,10,14,16,18-hexazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11(19),12,14-tetraen-17-one (PubChem CID 165158619) has the molecular formula C31H31Cl2N7O3 and a molecular weight of 620.54 g/mol. Its IUPAC name is 12-chloro-13-(2-chloro-6-hydroxyphenyl)-16-(4-methyl-2-propan-2-yl-3-pyridinyl)-5-prop-2-enoyl-2,5,10,14,16,18-hexazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11(19),12,14-tetraen-17-one.
| Compound Name | 12-chloro-13-(2-chloro-6-hydroxyphenyl)-16-(4-methyl-2-propan-2-yl-3-pyridinyl)-5-prop-2-enoyl-2,5,10,14,16,18-hexazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11(19),12,14-tetraen-17-one |
|---|---|
| PubChem CID | 165158619 |
| Molecular Formula | C31H31Cl2N7O3 |
| Molecular Weight | 620.54 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | 12-chloro-13-(2-chloro-6-hydroxyphenyl)-16-(4-methyl-2-propan-2-yl-3-pyridinyl)-5-prop-2-enoyl-2,5,10,14,16,18-hexazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11(19),12,14-tetraen-17-one |
| SMILES | C=CC(=O)N1CCN2c3nc(=O)n(-c4c(C)ccnc4C(C)C)c4nc(-c5c(O)cccc5Cl)c(Cl)c(c34)NCCC2C1 |
| InChI | InChI=1S/C31H31Cl2N7O3/c1-5-21(42)38-13-14-39-18(15-38)10-12-35-26-23-29(39)37-31(43)40(28-17(4)9-11-34-25(28)16(2)3)30(23)36-27(24(26)33)22-19(32)7-6-8-20(22)41/h5-9,11,16,18,35,41H,1,10,12-15H2,2-4H3 |
| InChIKey | YITRJBYZAVTCMP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|