C31H31ClFN7O3 — CID 165159777
12-(2-chloro-6-hydroxyphenyl)-11-fluoro-4-methyl-15-(4-methyl-2-propan-2-yl-3-pyridinyl)-5-prop-2-enoyl-2,5,9,13,15,17-hexazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraen-16-one (PubChem CID 165159777) has the molecular formula C31H31ClFN7O3 and a molecular weight of 604.09 g/mol. Its IUPAC name is 12-(2-chloro-6-hydroxyphenyl)-11-fluoro-4-methyl-15-(4-methyl-2-propan-2-yl-3-pyridinyl)-5-prop-2-enoyl-2,5,9,13,15,17-hexazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraen-16-one.
| Compound Name | 12-(2-chloro-6-hydroxyphenyl)-11-fluoro-4-methyl-15-(4-methyl-2-propan-2-yl-3-pyridinyl)-5-prop-2-enoyl-2,5,9,13,15,17-hexazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraen-16-one |
|---|---|
| PubChem CID | 165159777 |
| Molecular Formula | C31H31ClFN7O3 |
| Molecular Weight | 604.09 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | 12-(2-chloro-6-hydroxyphenyl)-11-fluoro-4-methyl-15-(4-methyl-2-propan-2-yl-3-pyridinyl)-5-prop-2-enoyl-2,5,9,13,15,17-hexazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraen-16-one |
| SMILES | C=CC(=O)N1CC2CNc3c(F)c(-c4c(O)cccc4Cl)nc4c3c(nc(=O)n4-c3c(C)ccnc3C(C)C)N2CC1C |
| InChI | InChI=1S/C31H31ClFN7O3/c1-6-21(42)38-14-18-12-35-26-23-29(39(18)13-17(38)5)37-31(43)40(28-16(4)10-11-34-25(28)15(2)3)30(23)36-27(24(26)33)22-19(32)8-7-9-20(22)41/h6-11,15,17-18,35,41H,1,12-14H2,2-5H3 |
| InChIKey | WXISCNJSBGFOQE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.09 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|