C31H30ClFN8O4 — CID 165159383
11-chloro-15-[4,6-di(propan-2-yl)pyrimidin-5-yl]-12-(2-fluoro-6-hydroxyphenyl)-5-prop-2-enoyl-2,5,9,13,15,17-hexazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraene-8,16-dione (PubChem CID 165159383) has the molecular formula C31H30ClFN8O4 and a molecular weight of 633.08 g/mol. Its IUPAC name is 11-chloro-15-[4,6-di(propan-2-yl)pyrimidin-5-yl]-12-(2-fluoro-6-hydroxyphenyl)-5-prop-2-enoyl-2,5,9,13,15,17-hexazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraene-8,16-dione.
| Compound Name | 11-chloro-15-[4,6-di(propan-2-yl)pyrimidin-5-yl]-12-(2-fluoro-6-hydroxyphenyl)-5-prop-2-enoyl-2,5,9,13,15,17-hexazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraene-8,16-dione |
|---|---|
| PubChem CID | 165159383 |
| Molecular Formula | C31H30ClFN8O4 |
| Molecular Weight | 633.08 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | 11-chloro-15-[4,6-di(propan-2-yl)pyrimidin-5-yl]-12-(2-fluoro-6-hydroxyphenyl)-5-prop-2-enoyl-2,5,9,13,15,17-hexazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13-tetraene-8,16-dione |
| SMILES | C=CC(=O)N1CCN2c3nc(=O)n(-c4c(C(C)C)ncnc4C(C)C)c4nc(-c5c(O)cccc5F)c(Cl)c(c34)NC(=O)C2C1 |
| InChI | InChI=1S/C31H30ClFN8O4/c1-6-19(43)39-10-11-40-17(12-39)30(44)37-26-21-28(40)38-31(45)41(27-23(14(2)3)34-13-35-24(27)15(4)5)29(21)36-25(22(26)32)20-16(33)8-7-9-18(20)42/h6-9,13-15,17,42H,1,10-12H2,2-5H3,(H,37,44) |
| InChIKey | HMGSRYWEQLHODK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.08 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|