C23H28ClIN2O3 — CID 165164047
2-[4-(4-chlorobenzoyl)phenoxy]-1-(4,4-dimethylpiperazin-4-ium-1-yl)-2-methylpropan-1-one iodide (PubChem CID 165164047) has the molecular formula C23H28ClIN2O3 and a molecular weight of 542.85 g/mol. Its IUPAC name is 2-[4-(4-chlorobenzoyl)phenoxy]-1-(4,4-dimethylpiperazin-4-ium-1-yl)-2-methylpropan-1-one iodide.
| Compound Name | 2-[4-(4-chlorobenzoyl)phenoxy]-1-(4,4-dimethylpiperazin-4-ium-1-yl)-2-methylpropan-1-one iodide |
|---|---|
| PubChem CID | 165164047 |
| Molecular Formula | C23H28ClIN2O3 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | 2-[4-(4-chlorobenzoyl)phenoxy]-1-(4,4-dimethylpiperazin-4-ium-1-yl)-2-methylpropan-1-one iodide |
| SMILES | CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)N1CC[N+](C)(C)CC1.[I-] |
| InChI | InChI=1S/C23H28ClN2O3.HI/c1-23(2,22(28)25-13-15-26(3,4)16-14-25)29-20-11-7-18(8-12-20)21(27)17-5-9-19(24)10-6-17;/h5-12H,13-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | LNMIKQOLCOAHRJ-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|