C27H33ClN2O3 — CID 167632774
2-[4-(4-chlorobenzoyl)phenoxy]-2-methyl-1-(4-piperidin-1-ylpiperidin-1-yl)propan-1-one (PubChem CID 167632774) has the molecular formula C27H33ClN2O3 and a molecular weight of 469.03 g/mol. Its IUPAC name is 2-[4-(4-chlorobenzoyl)phenoxy]-2-methyl-1-(4-piperidin-1-ylpiperidin-1-yl)propan-1-one.
| Compound Name | 2-[4-(4-chlorobenzoyl)phenoxy]-2-methyl-1-(4-piperidin-1-ylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 167632774 |
| Molecular Formula | C27H33ClN2O3 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2-[4-(4-chlorobenzoyl)phenoxy]-2-methyl-1-(4-piperidin-1-ylpiperidin-1-yl)propan-1-one |
| SMILES | CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C27H33ClN2O3/c1-27(2,26(32)30-18-14-23(15-19-30)29-16-4-3-5-17-29)33-24-12-8-21(9-13-24)25(31)20-6-10-22(28)11-7-20/h6-13,23H,3-5,14-19H2,1-2H3 |
| InChIKey | VKEIAPHUWJMRJQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |