C45H28N4S — CID 165166047
9-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-2-(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 165166047) has the molecular formula C45H28N4S and a molecular weight of 661.84 g/mol. Its IUPAC name is 9-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-2-(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 9-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-2-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 165166047 |
| Molecular Formula | C45H28N4S |
| Molecular Weight | 661.84 g/mol |
| Exact Mass | 661.23 |
| IUPAC Name | 9-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-2-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c4ccccc4n(-c4cccc5c4sc4cc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)ccc45)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H28N4S/c1-4-13-29(14-5-1)32-23-25-35-34-19-10-11-21-38(34)49(40(35)27-32)39-22-12-20-37-36-26-24-33(28-41(36)50-42(37)39)45-47-43(30-15-6-2-7-16-30)46-44(48-45)31-17-8-3-9-18-31/h1-28H/i1D,4D,5D,13D,14D |
| InChIKey | WVNVCZUABPBWDR-IKCIEKSKSA-N |
| XLogP | 12.00 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.84 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |