C45H26N4S2 — CID 162055550
9-[8-[4-dibenzothiophen-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzothiophen-4-yl]carbazole (PubChem CID 162055550) has the molecular formula C45H26N4S2 and a molecular weight of 691.90 g/mol. Its IUPAC name is 9-[8-[4-dibenzothiophen-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzothiophen-4-yl]carbazole.
| Compound Name | 9-[8-[4-dibenzothiophen-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzothiophen-4-yl]carbazole |
|---|---|
| PubChem CID | 162055550 |
| Molecular Formula | C45H26N4S2 |
| Molecular Weight | 691.90 g/mol |
| Exact Mass | 691.19 |
| IUPAC Name | 9-[8-[4-dibenzothiophen-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzothiophen-4-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4sc5c(-n6c7ccccc7c7ccccc76)cccc5c4c3)nc(-c3cccc4c3sc3ccccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H26N4S2/c1-2-12-27(13-3-1)43-46-44(48-45(47-43)34-19-10-17-32-31-16-6-9-23-39(31)50-41(32)34)28-24-25-40-35(26-28)33-18-11-22-38(42(33)51-40)49-36-20-7-4-14-29(36)30-15-5-8-21-37(30)49/h1-26H/i1D,2D,3D,12D,13D |
| InChIKey | FSXFZZBEETWJDT-AYAICNHJSA-N |
| XLogP | 12.71 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.90 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |