C45H26N4OS — CID 158219453
9-[7-[4-dibenzothiophen-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]carbazole (PubChem CID 158219453) has the molecular formula C45H26N4OS and a molecular weight of 675.83 g/mol. Its IUPAC name is 9-[7-[4-dibenzothiophen-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]carbazole.
| Compound Name | 9-[7-[4-dibenzothiophen-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]carbazole |
|---|---|
| PubChem CID | 158219453 |
| Molecular Formula | C45H26N4OS |
| Molecular Weight | 675.83 g/mol |
| Exact Mass | 675.21 |
| IUPAC Name | 9-[7-[4-dibenzothiophen-4-yl-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzofuran-3-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4c(c3)oc3cc(-n5c6ccccc6c6ccccc65)ccc34)nc(-c3cccc4c3sc3ccccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H26N4OS/c1-2-11-27(12-3-1)43-46-44(48-45(47-43)36-17-10-16-35-34-15-6-9-20-41(34)51-42(35)36)28-21-23-32-33-24-22-29(26-40(33)50-39(32)25-28)49-37-18-7-4-13-30(37)31-14-5-8-19-38(31)49/h1-26H/i1D,2D,3D,11D,12D |
| InChIKey | WUMKHURDWYBIAU-QJJXXHCMSA-N |
| XLogP | 12.24 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.83 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |