C48H32N4S — CID 165166124
5-[7-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzothiophen-1-yl]-7,7-dimethylindeno[2,1-b]carbazole (PubChem CID 165166124) has the molecular formula C48H32N4S and a molecular weight of 706.94 g/mol. Its IUPAC name is 5-[7-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzothiophen-1-yl]-7,7-dimethylindeno[2,1-b]carbazole.
| Compound Name | 5-[7-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzothiophen-1-yl]-7,7-dimethylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 165166124 |
| Molecular Formula | C48H32N4S |
| Molecular Weight | 706.94 g/mol |
| Exact Mass | 706.30 |
| IUPAC Name | 5-[7-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]dibenzothiophen-1-yl]-7,7-dimethylindeno[2,1-b]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4c(c3)sc3cccc(-n5c6ccccc6c6cc7c(cc65)C(C)(C)c5ccccc5-7)c34)nc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])n2)c([2H])c1[2H] |
| InChI | InChI=1S/C48H32N4S/c1-48(2)37-20-11-9-18-32(37)35-27-36-33-19-10-12-21-39(33)52(41(36)28-38(35)48)40-22-13-23-42-44(40)34-25-24-31(26-43(34)53-42)47-50-45(29-14-5-3-6-15-29)49-46(51-47)30-16-7-4-8-17-30/h3-28H,1-2H3/i3D,4D,5D,6D,7D,8D,14D,15D,16D,17D |
| InChIKey | SSTJCIAULTYBGM-ZBXCMJELSA-N |
| XLogP | 12.64 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.94 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |