C51H100O5S — CID 165166337
[(9S,10R)-10-(2-hexyldecanoyloxy)-19-hydroxysulfanylnonadecan-9-yl] 2-hexyldecanoate (PubChem CID 165166337) has the molecular formula C51H100O5S and a molecular weight of 825.42 g/mol. Its IUPAC name is [(9S,10R)-10-(2-hexyldecanoyloxy)-19-hydroxysulfanylnonadecan-9-yl] 2-hexyldecanoate.
| Compound Name | [(9S,10R)-10-(2-hexyldecanoyloxy)-19-hydroxysulfanylnonadecan-9-yl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 165166337 |
| Molecular Formula | C51H100O5S |
| Molecular Weight | 825.42 g/mol |
| Exact Mass | 824.73 |
| IUPAC Name | [(9S,10R)-10-(2-hexyldecanoyloxy)-19-hydroxysulfanylnonadecan-9-yl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)O[C@@H](CCCCCCCC)[C@@H](CCCCCCCCCSO)OC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C51H100O5S/c1-6-11-16-21-27-34-41-46(39-32-19-14-9-4)50(52)55-48(43-36-29-23-18-13-8-3)49(44-37-30-25-24-26-31-38-45-57-54)56-51(53)47(40-33-20-15-10-5)42-35-28-22-17-12-7-2/h46-49,54H,6-45H2,1-5H3/t46?,47?,48-,49+/m0/s1 |
| InChIKey | SJKDXIFWUUOGOR-KDZUSWFMSA-N |
| XLogP | 17.56 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.42 |
| LogP ≤ 5 | 17.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|