C45H29N5 — CID 165168236
2,4-diphenyl-6-[10-[4-(6-pyridin-2-yl-3-pyridinyl)phenyl]anthracen-9-yl]-1,3,5-triazine (PubChem CID 165168236) has the molecular formula C45H29N5 and a molecular weight of 639.76 g/mol. Its IUPAC name is 2,4-diphenyl-6-[10-[4-(6-pyridin-2-yl-3-pyridinyl)phenyl]anthracen-9-yl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[10-[4-(6-pyridin-2-yl-3-pyridinyl)phenyl]anthracen-9-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 165168236 |
| Molecular Formula | C45H29N5 |
| Molecular Weight | 639.76 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | 2,4-diphenyl-6-[10-[4-(6-pyridin-2-yl-3-pyridinyl)phenyl]anthracen-9-yl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3c4ccccc4c(-c4ccc(-c5ccc(-c6ccccn6)nc5)cc4)c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C45H29N5/c1-3-13-32(14-4-1)43-48-44(33-15-5-2-6-16-33)50-45(49-43)42-37-19-9-7-17-35(37)41(36-18-8-10-20-38(36)42)31-24-22-30(23-25-31)34-26-27-40(47-29-34)39-21-11-12-28-46-39/h1-29H |
| InChIKey | IPMWKFQXBPOMIF-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.76 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|