C46H33NO — CID 165170010
5,6,7,8-tetradeuterio-N,N-dimethyl-9-phenyl-10-[4-(2-phenyldibenzofuran-1-yl)phenyl]anthracen-2-amine (PubChem CID 165170010) has the molecular formula C46H33NO and a molecular weight of 619.80 g/mol. Its IUPAC name is 5,6,7,8-tetradeuterio-N,N-dimethyl-9-phenyl-10-[4-(2-phenyldibenzofuran-1-yl)phenyl]anthracen-2-amine.
| Compound Name | 5,6,7,8-tetradeuterio-N,N-dimethyl-9-phenyl-10-[4-(2-phenyldibenzofuran-1-yl)phenyl]anthracen-2-amine |
|---|---|
| PubChem CID | 165170010 |
| Molecular Formula | C46H33NO |
| Molecular Weight | 619.80 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | 5,6,7,8-tetradeuterio-N,N-dimethyl-9-phenyl-10-[4-(2-phenyldibenzofuran-1-yl)phenyl]anthracen-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccccc3)c3cc(N(C)C)ccc3c(-c3ccc(-c4c(-c5ccccc5)ccc5oc6ccccc6c45)cc3)c2c1[2H] |
| InChI | InChI=1S/C46H33NO/c1-47(2)34-25-26-38-40(29-34)44(31-15-7-4-8-16-31)37-18-10-9-17-36(37)43(38)32-21-23-33(24-22-32)45-35(30-13-5-3-6-14-30)27-28-42-46(45)39-19-11-12-20-41(39)48-42/h3-29H,1-2H3/i9D,10D,17D,18D |
| InChIKey | KJCVCINEARRRQN-DQRDBBFKSA-N |
| XLogP | 12.63 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.80 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|