C40H24O2 — CID 176744305
1-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)phenyl]-[1]benzofuro[3,2-e][1]benzofuran (PubChem CID 176744305) has the molecular formula C40H24O2 and a molecular weight of 544.68 g/mol. Its IUPAC name is 1-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)phenyl]-[1]benzofuro[3,2-e][1]benzofuran.
| Compound Name | 1-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)phenyl]-[1]benzofuro[3,2-e][1]benzofuran |
|---|---|
| PubChem CID | 176744305 |
| Molecular Formula | C40H24O2 |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 1-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracen-9-yl)phenyl]-[1]benzofuro[3,2-e][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc(-c4coc5ccc6oc7ccccc7c6c45)cc3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccccc3)c2c1[2H] |
| InChI | InChI=1S/C40H24O2/c1-2-10-26(11-3-1)37-28-12-4-6-14-30(28)38(31-15-7-5-13-29(31)37)27-20-18-25(19-21-27)33-24-41-35-22-23-36-39(40(33)35)32-16-8-9-17-34(32)42-36/h1-24H/i4D,5D,6D,7D,12D,13D,14D,15D |
| InChIKey | OTAUFEHEQQCHBO-PWJXYKMLSA-N |
| XLogP | 11.64 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|