C39H26O — CID 167419564
1-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]phenyl]dibenzofuran (PubChem CID 167419564) has the molecular formula C39H26O and a molecular weight of 523.72 g/mol. Its IUPAC name is 1-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]phenyl]dibenzofuran.
| Compound Name | 1-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]phenyl]dibenzofuran |
|---|---|
| PubChem CID | 167419564 |
| Molecular Formula | C39H26O |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 1-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]phenyl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(Cc2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc(-c4cccc5oc6ccccc6c45)cc3)c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C39H26O/c1-2-11-26(12-3-1)25-35-30-13-4-6-15-32(30)38(33-16-7-5-14-31(33)35)28-23-21-27(22-24-28)29-18-10-20-37-39(29)34-17-8-9-19-36(34)40-37/h1-24H,25H2/i1D,2D,3D,4D,5D,6D,7D,11D,12D,13D,14D,15D,16D |
| InChIKey | LNXDXNDKTNWDTB-HXVPAKNWSA-N |
| XLogP | 10.82 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|