C45H30O — CID 167419561
4-phenyl-6-[2,3,5,6-tetradeuterio-4-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]phenyl]dibenzofuran (PubChem CID 167419561) has the molecular formula C45H30O and a molecular weight of 603.84 g/mol. Its IUPAC name is 4-phenyl-6-[2,3,5,6-tetradeuterio-4-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]phenyl]dibenzofuran.
| Compound Name | 4-phenyl-6-[2,3,5,6-tetradeuterio-4-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]phenyl]dibenzofuran |
|---|---|
| PubChem CID | 167419561 |
| Molecular Formula | C45H30O |
| Molecular Weight | 603.84 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | 4-phenyl-6-[2,3,5,6-tetradeuterio-4-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]phenyl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(Cc2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3c([2H])c([2H])c(-c4cccc5c4oc4c(-c6ccccc6)cccc45)c([2H])c3[2H])c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C45H30O/c1-3-13-30(14-4-1)29-42-36-17-7-9-19-38(36)43(39-20-10-8-18-37(39)42)33-27-25-32(26-28-33)35-22-12-24-41-40-23-11-21-34(44(40)46-45(35)41)31-15-5-2-6-16-31/h1-28H,29H2/i1D,3D,4D,7D,8D,9D,10D,13D,14D,17D,18D,19D,20D,25D,26D,27D,28D |
| InChIKey | VRXVDZYJHDDNMR-HNQPFBLFSA-N |
| XLogP | 12.48 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.84 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|