C46H32O — CID 167419066
1-phenyl-6-[2,3,4,6-tetradeuterio-5-[[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]methyl]phenyl]dibenzofuran (PubChem CID 167419066) has the molecular formula C46H32O and a molecular weight of 617.86 g/mol. Its IUPAC name is 1-phenyl-6-[2,3,4,6-tetradeuterio-5-[[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]methyl]phenyl]dibenzofuran.
| Compound Name | 1-phenyl-6-[2,3,4,6-tetradeuterio-5-[[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]methyl]phenyl]dibenzofuran |
|---|---|
| PubChem CID | 167419066 |
| Molecular Formula | C46H32O |
| Molecular Weight | 617.86 g/mol |
| Exact Mass | 617.35 |
| IUPAC Name | 1-phenyl-6-[2,3,4,6-tetradeuterio-5-[[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]methyl]phenyl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(Cc2c3c([2H])c([2H])c([2H])c([2H])c3c(Cc3c([2H])c([2H])c([2H])c(-c4cccc5c4oc4cccc(-c6ccccc6)c45)c3[2H])c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C46H32O/c1-3-14-31(15-4-1)29-42-37-20-7-9-22-39(37)43(40-23-10-8-21-38(40)42)30-32-16-11-19-34(28-32)36-25-12-26-41-45-35(33-17-5-2-6-18-33)24-13-27-44(45)47-46(36)41/h1-28H,29-30H2/i1D,3D,4D,7D,8D,9D,10D,11D,14D,15D,16D,19D,20D,21D,22D,23D,28D |
| InChIKey | JRRJFIXIBVTPRQ-LIVWDGMGSA-N |
| XLogP | 12.41 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.86 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|