C53H34O — CID 167419358
1-naphthalen-1-yl-6-[6-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]naphthalen-2-yl]dibenzofuran (PubChem CID 167419358) has the molecular formula C53H34O and a molecular weight of 699.93 g/mol. Its IUPAC name is 1-naphthalen-1-yl-6-[6-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]naphthalen-2-yl]dibenzofuran.
| Compound Name | 1-naphthalen-1-yl-6-[6-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]naphthalen-2-yl]dibenzofuran |
|---|---|
| PubChem CID | 167419358 |
| Molecular Formula | C53H34O |
| Molecular Weight | 699.93 g/mol |
| Exact Mass | 699.34 |
| IUPAC Name | 1-naphthalen-1-yl-6-[6-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]naphthalen-2-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(Cc2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc4cc(-c5cccc6c5oc5cccc(-c7cccc8ccccc78)c56)ccc4c3)c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C53H34O/c1-2-13-34(14-3-1)31-49-43-18-6-8-20-45(43)51(46-21-9-7-19-44(46)49)39-30-28-36-32-38(29-27-37(36)33-39)41-22-11-25-48-52-47(24-12-26-50(52)54-53(41)48)42-23-10-16-35-15-4-5-17-40(35)42/h1-30,32-33H,31H2/i1D,2D,3D,6D,7D,8D,9D,13D,14D,18D,19D,20D,21D |
| InChIKey | OAFKHMRJSXIISE-YGUGWDIWSA-N |
| XLogP | 14.79 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.93 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|