C49H32O — CID 167419176
6-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]naphthalen-1-yl]-3-phenyldibenzofuran (PubChem CID 167419176) has the molecular formula C49H32O and a molecular weight of 649.87 g/mol. Its IUPAC name is 6-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]naphthalen-1-yl]-3-phenyldibenzofuran.
| Compound Name | 6-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]naphthalen-1-yl]-3-phenyldibenzofuran |
|---|---|
| PubChem CID | 167419176 |
| Molecular Formula | C49H32O |
| Molecular Weight | 649.87 g/mol |
| Exact Mass | 649.33 |
| IUPAC Name | 6-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-[(2,3,4,5,6-pentadeuteriophenyl)methyl]anthracen-9-yl]naphthalen-1-yl]-3-phenyldibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(Cc2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc(-c4cccc5c4oc4cc(-c6ccccc6)ccc45)c4ccccc34)c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C49H32O/c1-3-14-32(15-4-1)30-46-37-20-9-11-22-41(37)48(42-23-12-10-21-38(42)46)43-29-28-39(35-18-7-8-19-36(35)43)44-24-13-25-45-40-27-26-34(31-47(40)50-49(44)45)33-16-5-2-6-17-33/h1-29,31H,30H2/i1D,3D,4D,9D,10D,11D,12D,14D,15D,20D,21D,22D,23D |
| InChIKey | LJSXNWYFXSQWKZ-WDYFXUTLSA-N |
| XLogP | 13.64 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.87 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|