About 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one
3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one (PubChem CID 165171617) has the molecular formula C11H12ClN5O
and a molecular weight of 265.70 g/mol. Its IUPAC name is 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one.
Molecular Properties
| Compound Name | 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one |
| PubChem CID | 165171617 |
| Molecular Formula | C11H12ClN5O |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one |
| SMILES | O=C1NCCCC1Cn1ncc2cnc(Cl)nc21 |
| InChI | InChI=1S/C11H12ClN5O/c12-11-14-4-8-5-15-17(9(8)16-11)6-7-2-1-3-13-10(7)18/h4-5,7H,1-3,6H2,(H,13,18) |
| InChIKey | IYBCRXITMICTMI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one?
The IUPAC name of 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one (CID 165171617) is 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one.
What is the SMILES notation for 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one?
The canonical SMILES for 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one is O=C1NCCCC1Cn1ncc2cnc(Cl)nc21.
What is the InChIKey of 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one?
The InChIKey is IYBCRXITMICTMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN5O/c12-11-14-4-8-5-15-17(9(8)16-11)6-7-2-1-3-13-10(7)18/h4-5,7H,1-3,6H2,(H,13,18).
What are the key properties of 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one?
3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one has a molecular weight of 265.70 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-chloropyrazolo[3,4-d]pyrimidin-1-yl)methyl]piperidin-2-one is sourced from PubChem (CID 165171617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).