C12H15ClN4 — CID 172599841
6-chloro-1-(cyclohexylmethyl)pyrazolo[3,4-d]pyrimidine (PubChem CID 172599841) has the molecular formula C12H15ClN4 and a molecular weight of 250.73 g/mol. Its IUPAC name is 6-chloro-1-(cyclohexylmethyl)pyrazolo[3,4-d]pyrimidine.
| Compound Name | 6-chloro-1-(cyclohexylmethyl)pyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 172599841 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 6-chloro-1-(cyclohexylmethyl)pyrazolo[3,4-d]pyrimidine |
| SMILES | Clc1ncc2cnn(CC3CCCCC3)c2n1 |
| InChI | InChI=1S/C12H15ClN4/c13-12-14-6-10-7-15-17(11(10)16-12)8-9-4-2-1-3-5-9/h6-7,9H,1-5,8H2 |
| InChIKey | KSVOSRDUYKUVJG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |