About 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride
1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride (PubChem CID 172599757) has the molecular formula C17H27ClN6
and a molecular weight of 350.90 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride |
| PubChem CID | 172599757 |
| Molecular Formula | C17H27ClN6 |
| Molecular Weight | 350.90 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride |
| SMILES | Cl.c1nc(NC2CCNCC2)nc2c1cnn2CC1CCCCC1 |
| InChI | InChI=1S/C17H26N6.ClH/c1-2-4-13(5-3-1)12-23-16-14(11-20-23)10-19-17(22-16)21-15-6-8-18-9-7-15;/h10-11,13,15,18H,1-9,12H2,(H,19,21,22);1H |
| InChIKey | RRABEWIBKUHNCY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.90 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride?
The IUPAC name of 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride (CID 172599757) is 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride.
What is the SMILES notation for 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride?
The canonical SMILES for 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride is Cl.c1nc(NC2CCNCC2)nc2c1cnn2CC1CCCCC1.
What is the InChIKey of 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride?
The InChIKey is RRABEWIBKUHNCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N6.ClH/c1-2-4-13(5-3-1)12-23-16-14(11-20-23)10-19-17(22-16)21-15-6-8-18-9-7-15;/h10-11,13,15,18H,1-9,12H2,(H,19,21,22);1H.
What are the key properties of 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride?
1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride has a molecular weight of 350.90 g/mol, XLogP of 2.99, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethyl)-N-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-6-amine;hydrochloride is sourced from PubChem (CID 172599757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).