C20H24ClN5O2S — CID 172599903
1-[[4-(chloromethyl)cyclohexyl]methyl]-N-(4-methylsulfonylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 172599903) has the molecular formula C20H24ClN5O2S and a molecular weight of 433.97 g/mol. Its IUPAC name is 1-[[4-(chloromethyl)cyclohexyl]methyl]-N-(4-methylsulfonylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 1-[[4-(chloromethyl)cyclohexyl]methyl]-N-(4-methylsulfonylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 172599903 |
| Molecular Formula | C20H24ClN5O2S |
| Molecular Weight | 433.97 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 1-[[4-(chloromethyl)cyclohexyl]methyl]-N-(4-methylsulfonylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2ncc3cnn(CC4CCC(CCl)CC4)c3n2)cc1 |
| InChI | InChI=1S/C20H24ClN5O2S/c1-29(27,28)18-8-6-17(7-9-18)24-20-22-11-16-12-23-26(19(16)25-20)13-15-4-2-14(10-21)3-5-15/h6-9,11-12,14-15H,2-5,10,13H2,1H3,(H,22,24,25) |
| InChIKey | OQELBBBZFAYINR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.97 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|