C13H18N4 — CID 166460327
1-(cyclohexylmethyl)pyrazolo[4,3-c]pyridin-6-amine (PubChem CID 166460327) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)pyrazolo[4,3-c]pyridin-6-amine.
| Compound Name | 1-(cyclohexylmethyl)pyrazolo[4,3-c]pyridin-6-amine |
|---|---|
| PubChem CID | 166460327 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-(cyclohexylmethyl)pyrazolo[4,3-c]pyridin-6-amine |
| SMILES | Nc1cc2c(cn1)cnn2CC1CCCCC1 |
| InChI | InChI=1S/C13H18N4/c14-13-6-12-11(7-15-13)8-16-17(12)9-10-4-2-1-3-5-10/h6-8,10H,1-5,9H2,(H2,14,15) |
| InChIKey | QNCBVSAXIWPVKZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |