C7H12N2O4 — CID 165174482
(3S)-3-amino-4-(1,3-oxazolidin-3-yl)-4-oxobutanoic acid (PubChem CID 165174482) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is (3S)-3-amino-4-(1,3-oxazolidin-3-yl)-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-(1,3-oxazolidin-3-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 165174482 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (3S)-3-amino-4-(1,3-oxazolidin-3-yl)-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)N1CCOC1 |
| InChI | InChI=1S/C7H12N2O4/c8-5(3-6(10)11)7(12)9-1-2-13-4-9/h5H,1-4,8H2,(H,10,11)/t5-/m0/s1 |
| InChIKey | DHOVGIQHAOBPSW-YFKPBYRVSA-N |
| XLogP | -1.40 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |