C26H29N7O3 — CID 165176071
(E)-N-[2-[3-[2-[2-(4-morpholin-4-ylphenyl)hydrazinyl]pyrimidin-4-yl]anilino]-2-oxoethyl]but-2-enamide (PubChem CID 165176071) has the molecular formula C26H29N7O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is (E)-N-[2-[3-[2-[2-(4-morpholin-4-ylphenyl)hydrazinyl]pyrimidin-4-yl]anilino]-2-oxoethyl]but-2-enamide.
| Compound Name | (E)-N-[2-[3-[2-[2-(4-morpholin-4-ylphenyl)hydrazinyl]pyrimidin-4-yl]anilino]-2-oxoethyl]but-2-enamide |
|---|---|
| PubChem CID | 165176071 |
| Molecular Formula | C26H29N7O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | (E)-N-[2-[3-[2-[2-(4-morpholin-4-ylphenyl)hydrazinyl]pyrimidin-4-yl]anilino]-2-oxoethyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCC(=O)Nc1cccc(-c2ccnc(NNc3ccc(N4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C26H29N7O3/c1-2-4-24(34)28-18-25(35)29-21-6-3-5-19(17-21)23-11-12-27-26(30-23)32-31-20-7-9-22(10-8-20)33-13-15-36-16-14-33/h2-12,17,31H,13-16,18H2,1H3,(H,28,34)(H,29,35)(H,27,30,32)/b4-2+ |
| InChIKey | CHJFENHKUSLIBV-DUXPYHPUSA-N |
| XLogP | 3.05 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|