C18H32N4O5 — CID 165176098
tert-butyl N-cyclopropyl-N-[[(2S)-4-(6-nitropiperidin-3-yl)morpholin-2-yl]methyl]carbamate (PubChem CID 165176098) has the molecular formula C18H32N4O5 and a molecular weight of 384.48 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[[(2S)-4-(6-nitropiperidin-3-yl)morpholin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-cyclopropyl-N-[[(2S)-4-(6-nitropiperidin-3-yl)morpholin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 165176098 |
| Molecular Formula | C18H32N4O5 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[[(2S)-4-(6-nitropiperidin-3-yl)morpholin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C[C@@H]1CN(C2CCC([N+](=O)[O-])NC2)CCO1)C1CC1 |
| InChI | InChI=1S/C18H32N4O5/c1-18(2,3)27-17(23)21(13-4-5-13)12-15-11-20(8-9-26-15)14-6-7-16(19-10-14)22(24)25/h13-16,19H,4-12H2,1-3H3/t14?,15-,16?/m0/s1 |
| InChIKey | HEFLTNFQWRQLRV-PCKAHOCUSA-N |
| XLogP | 1.44 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|