About [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate
[4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate (PubChem CID 175330301) has the molecular formula C17H32N4O5
and a molecular weight of 372.47 g/mol. Its IUPAC name is [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate.
Molecular Properties
| Compound Name | [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate |
| PubChem CID | 175330301 |
| Molecular Formula | C17H32N4O5 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate |
| SMILES | CC(C)(C)CC(C)(OC(N)=O)C1CN(C2CCC([N+](=O)[O-])NC2)CCO1 |
| InChI | InChI=1S/C17H32N4O5/c1-16(2,3)11-17(4,26-15(18)22)13-10-20(7-8-25-13)12-5-6-14(19-9-12)21(23)24/h12-14,19H,5-11H2,1-4H3,(H2,18,22) |
| InChIKey | CFSXCUGBXHXHNT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate?
The IUPAC name of [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate (CID 175330301) is [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate.
What is the SMILES notation for [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate?
The canonical SMILES for [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate is CC(C)(C)CC(C)(OC(N)=O)C1CN(C2CCC([N+](=O)[O-])NC2)CCO1.
What is the InChIKey of [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate?
The InChIKey is CFSXCUGBXHXHNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N4O5/c1-16(2,3)11-17(4,26-15(18)22)13-10-20(7-8-25-13)12-5-6-14(19-9-12)21(23)24/h12-14,19H,5-11H2,1-4H3,(H2,18,22).
What are the key properties of [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate?
[4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate has a molecular weight of 372.47 g/mol, XLogP of 1.33, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-dimethyl-2-[4-(6-nitropiperidin-3-yl)morpholin-2-yl]pentan-2-yl] carbamate is sourced from PubChem (CID 175330301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).