C15H28N4O4 — CID 175330286
tert-butyl N-[1-(6-nitropiperidin-3-yl)piperidin-3-yl]carbamate (PubChem CID 175330286) has the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl N-[1-(6-nitropiperidin-3-yl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(6-nitropiperidin-3-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 175330286 |
| Molecular Formula | C15H28N4O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | tert-butyl N-[1-(6-nitropiperidin-3-yl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(C2CCC([N+](=O)[O-])NC2)C1 |
| InChI | InChI=1S/C15H28N4O4/c1-15(2,3)23-14(20)17-11-5-4-8-18(10-11)12-6-7-13(16-9-12)19(21)22/h11-13,16H,4-10H2,1-3H3,(H,17,20) |
| InChIKey | FFUIRLGGGPRRFW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|