C14H24N4O5 — CID 165176103
tert-butyl N-[1-(6-nitropiperidin-2-yl)-5-oxopyrrolidin-3-yl]carbamate (PubChem CID 165176103) has the molecular formula C14H24N4O5 and a molecular weight of 328.37 g/mol. Its IUPAC name is tert-butyl N-[1-(6-nitropiperidin-2-yl)-5-oxopyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(6-nitropiperidin-2-yl)-5-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 165176103 |
| Molecular Formula | C14H24N4O5 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | tert-butyl N-[1-(6-nitropiperidin-2-yl)-5-oxopyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(=O)N(C2CCCC([N+](=O)[O-])N2)C1 |
| InChI | InChI=1S/C14H24N4O5/c1-14(2,3)23-13(20)15-9-7-12(19)17(8-9)10-5-4-6-11(16-10)18(21)22/h9-11,16H,4-8H2,1-3H3,(H,15,20) |
| InChIKey | KMBLKEVVIMQHDB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|